(4-ethylsulfinylphenyl) methanesulfonate structure
|
Common Name | (4-ethylsulfinylphenyl) methanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 36116-17-3 | Molecular Weight | 248.31900 | |
| Density | 1.41g/cm3 | Boiling Point | 439.4ºC at 760 mmHg | |
| Molecular Formula | C9H12O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.5ºC | |
| Name | (4-ethylsulfinylphenyl) methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 439.4ºC at 760 mmHg |
| Molecular Formula | C9H12O4S2 |
| Molecular Weight | 248.31900 |
| Flash Point | 219.5ºC |
| Exact Mass | 248.01800 |
| PSA | 88.03000 |
| LogP | 3.09900 |
| Index of Refraction | 1.599 |
| InChIKey | PUJNNPLDEBOBCE-UHFFFAOYSA-N |
| SMILES | CCS(=O)c1ccc(OS(C)(=O)=O)cc1 |
|
~%
(4-ethylsulfiny... CAS#:36116-17-3 |
| Literature: Rastogi; Anand; Prasad Journal of medicinal chemistry, 1972 , vol. 15, # 3 p. 286 - 291 |
|
~%
(4-ethylsulfiny... CAS#:36116-17-3 |
| Literature: Rastogi; Anand; Prasad Journal of medicinal chemistry, 1972 , vol. 15, # 3 p. 286 - 291 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phenol,4-(ethylsulfinyl)-,methanesulfonate |
| p-Ethylsulfinylphenyl-methansulfonat |
| p-Ethylsulfinylphenyl methanesulfonate |