1-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylpiperidin-4-one structure
|
Common Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylpiperidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 3612-15-5 | Molecular Weight | 277.35900 | |
| Density | 1.065g/cm3 | Boiling Point | 402.3ºC at 760 mmHg | |
| Molecular Formula | C16H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.1ºC | |
| Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-methylpiperidin-4-one |
|---|
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 402.3ºC at 760 mmHg |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.35900 |
| Flash Point | 197.1ºC |
| Exact Mass | 277.16800 |
| PSA | 38.77000 |
| LogP | 2.09510 |
| Index of Refraction | 1.516 |
| InChIKey | NOHZWMDXAWRJTG-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCN2CCC(=O)C(C)C2)cc1OC |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |