[1-(2-diethylaminoethylamino)-9-oxo-thioxanthen-4-yl]methyl N-phenylcarbamate
Modify Date: 2025-08-21 23:13:03
![[1-(2-diethylaminoethylamino)-9-oxo-thioxanthen-4-yl]methyl N-phenylcarbamate Structure](https://image.chemsrc.com/caspic/011/3612-74-6.png)
[1-(2-diethylaminoethylamino)-9-oxo-thioxanthen-4-yl]methyl N-phenylcarbamate structure
|
Common Name | [1-(2-diethylaminoethylamino)-9-oxo-thioxanthen-4-yl]methyl N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 3612-74-6 | Molecular Weight | 475.60200 | |
| Density | 1.28g/cm3 | Boiling Point | 640.9ºC at 760 mmHg | |
| Molecular Formula | C27H29N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.4ºC | |
| Name | [1-[2-(diethylamino)ethylamino]-9-oxothioxanthen-4-yl]methyl N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 640.9ºC at 760 mmHg |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.60200 |
| Flash Point | 341.4ºC |
| Exact Mass | 475.19300 |
| PSA | 98.91000 |
| LogP | 6.06310 |
| Index of Refraction | 1.672 |
| InChIKey | WCXUBVALLSZHIC-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNc1ccc(COC(=O)Nc2ccccc2)c2sc3ccccc3c(=O)c12 |
|
~97%
[1-(2-diethylam... CAS#:3612-74-6 |
| Literature: Archer; Pica-Mattoccia; Cioli; Seyed-Mozaffari; Zayed Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 254 - 260 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hycanthone N-phenylcarbamate |