1-(2-diethylaminoethylamino)-4-(hydroxymethyl)xanthen-9-one
Modify Date: 2025-09-01 19:58:49
1-(2-diethylaminoethylamino)-4-(hydroxymethyl)xanthen-9-one structure
|
Common Name | 1-(2-diethylaminoethylamino)-4-(hydroxymethyl)xanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 3613-16-9 | Molecular Weight | 340.41600 | |
| Density | 1.23g/cm3 | Boiling Point | 540.2ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.5ºC | |
| Name | 1-[2-(diethylamino)ethylamino]-4-(hydroxymethyl)xanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 540.2ºC at 760 mmHg |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.41600 |
| Flash Point | 280.5ºC |
| Exact Mass | 340.17900 |
| PSA | 65.71000 |
| LogP | 3.26520 |
| Index of Refraction | 1.63 |
| InChIKey | FKEBOYZZRAPIFN-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNc1ccc(CO)c2oc3ccccc3c(=O)c12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-diethylamino-ethylamino)-4-hydroxymethyl-xanthen-9-one |
| 1-{[2-(Diethylamino)ethyl]amino}-4-(hydroxymethyl)-9H-xanthen-9-one |