Myoseverin B structure
|
Common Name | Myoseverin B | ||
|---|---|---|---|---|
| CAS Number | 361431-27-8 | Molecular Weight | 472.58200 | |
| Density | 1.278g/cm3 | Boiling Point | 714.814ºC at 760 mmHg | |
| Molecular Formula | C27H32N6O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 386.106ºC | |
| Name | 9-cyclohexyl-2-N,6-N-bis[(4-methoxyphenyl)methyl]purine-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.278g/cm3 |
|---|---|
| Boiling Point | 714.814ºC at 760 mmHg |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.58200 |
| Flash Point | 386.106ºC |
| Exact Mass | 472.25900 |
| PSA | 89.35000 |
| LogP | 5.06780 |
| Index of Refraction | 1.656 |
| InChIKey | ZUZXYJOSNSTJMU-UHFFFAOYSA-N |
| SMILES | COc1ccc(CNc2nc(NCc3ccc(OC)cc3)c3ncn(C4CCCCC4)c3n2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| Myoseverin B |
| 2,6-Bis(4-methoxybenzylamino)-9-cyclohexylpurine |