chlorprazophos structure
|
Common Name | chlorprazophos | ||
|---|---|---|---|---|
| CAS Number | 36145-08-1 | Molecular Weight | 335.74700 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H15ClN3O3PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chlorprazophos |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C11H15ClN3O3PS |
| Molecular Weight | 335.74700 |
| Exact Mass | 335.02600 |
| PSA | 99.78000 |
| LogP | 4.01800 |
| Index of Refraction | 1.624 |
| InChIKey | ZCMOTOWEBLMCEO-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)Oc1nn2c(C)ccnc2c1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| thiophosphoric acid O-(3-chloro-7-methyl-pyrazolo[1,5-a]pyrimidin-2-yl) ester O',O''-diethyl ester |
| (3-chloro-6-methylpyrazolo[1,5-a]pyrimidin-2-yl)oxy-diethoxy-sulfanylidene |
| Phosphorothioic acid,O-(3-chloro-7-methylpyrazolo(1,5-a)pyrimidin-2-yl) O,O-diethyl ester |
| Chlorprazophos [ISO] |
| O-(3-chloro-7-methylpyrazolo[1,5-a]pyrimidin-2-yl) O,O-diethyl phosphorothioate |
| O-(3-Chloro-7-methylpyrazolo(1,5-a)pyrimidin-2-yl) O,O-diethyl thiophosphate |
| (3-chloro-6-methylpyrazolo[1,5-a]pyrimidin-2-yl)oxy-diethoxy-sulfanylidene-λ<sup>5</sup>-phosphane |
| Chlorprazophos |