7,8-Dihydroblumenol A structure
|
Common Name | 7,8-Dihydroblumenol A | ||
|---|---|---|---|---|
| CAS Number | 36151-01-6 | Molecular Weight | 226.312 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 359.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.1±24.4 °C | |
Use of 7,8-Dihydroblumenol ABlumenol B, a C13 nor-isoprenoid, can be isolated from the leaves of Casearia sylvestris[1]. |
| Name | (4S)-4-Hydroxy-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethyl-2-cyclohex en-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Blumenol B, a C13 nor-isoprenoid, can be isolated from the leaves of Casearia sylvestris[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 359.1±42.0 °C at 760 mmHg |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.312 |
| Flash Point | 185.1±24.4 °C |
| Exact Mass | 226.156891 |
| PSA | 57.53000 |
| LogP | 0.91 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | CWOFGGNDZOPNFG-GWCFXTLKSA-N |
| SMILES | CC1=CC(=O)CC(C)(C)C1(O)CCC(C)O |
| HS Code | 2914400090 |
|---|
|
~%
7,8-Dihydroblum... CAS#:36151-01-6 |
| Literature: Miyase; Ueno; Takizawa; Kobayashi; Oguchi Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 7 p. 2475 - 2484 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 7,8-Dihydro-thiazolo<2.3-e>purin |
| (4S)-4-Hydroxy-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethyl-2-cyclohexen-1-one |
| 7,8-Dihydroblumenol A |
| dihydrovomifoliol |
| 7,8-dihydrovomifoliol |
| 7,8-Dihydropyrido<2,3-d>pyridazin |
| 2-Cyclohexen-1-one, 4-hydroxy-4-[(3R)-3-hydroxybutyl]-3,5,5-trimethyl-, (4S)- |