magnesium,1-chloro-4-ethylbenzene,bromide structure
|
Common Name | magnesium,1-chloro-4-ethylbenzene,bromide | ||
|---|---|---|---|---|
| CAS Number | 36159-18-9 | Molecular Weight | 243.81100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8BrClMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | magnesium,1-chloro-4-ethylbenzene,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8BrClMg |
|---|---|
| Molecular Weight | 243.81100 |
| Exact Mass | 241.93500 |
| LogP | 3.69570 |
| InChIKey | SJDUMBMHHUTCLK-UHFFFAOYSA-M |
| SMILES | [Br-].[CH2-]Cc1ccc(Cl)cc1.[Mg+2] |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 4-Chlorophenethylmagnesium bromide 0.5 M in Tetrahydrofuran |
| (4-chloro-phenethyl)-magnesium bromide |