(5-fluoro-2-hydroxyphenyl)-phenylmethanone structure
|
Common Name | (5-fluoro-2-hydroxyphenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 362-47-0 | Molecular Weight | 216.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9FO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-fluoro-2-hydroxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9FO2 |
|---|---|
| Molecular Weight | 216.20800 |
| Exact Mass | 216.05900 |
| PSA | 37.30000 |
| LogP | 2.76230 |
| InChIKey | BLAFMYLJPCNAIP-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1cc(F)ccc1O |
| HS Code | 2914700090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| PC6503 |
| 5-fluoro-2-hydroxyphenyl phenyl ketone |
| 2-benzoyl-4-fluorophenol |
| (5-fluoro-2-hydroxyphenyl)(phenyl)methanone |
| 2-hydroxy-5-fluorobenzophenone |
| 5-Fluor-2-hydroxy-benzophenon |
| 5-Fluoro-2-hydroxybenzophenone |