1-benzothiophen-3-yl-4,4,5,5,6,6,6-heptafluoro-hexane-1,3-dione structure
|
Common Name | 1-benzothiophen-3-yl-4,4,5,5,6,6,6-heptafluoro-hexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 362-57-2 | Molecular Weight | 372.25800 | |
| Density | 1.513g/cm3 | Boiling Point | 352.6ºC at 760 mmHg | |
| Molecular Formula | C14H7F7O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.1ºC | |
| Name | 1-(1-benzothiophen-3-yl)-4,4,5,5,6,6,6-heptafluorohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.513g/cm3 |
|---|---|
| Boiling Point | 352.6ºC at 760 mmHg |
| Molecular Formula | C14H7F7O2S |
| Molecular Weight | 372.25800 |
| Flash Point | 167.1ºC |
| Exact Mass | 372.00500 |
| PSA | 62.38000 |
| LogP | 4.87610 |
| Index of Refraction | 1.498 |
| InChIKey | MDUFGROXFHHGDP-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1csc2ccccc12 |
|
~%
1-benzothiophen... CAS#:362-57-2 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1951 , vol. 73, p. 4625 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Benzo[b]thiophen-3-yl-2H,2H-heptafluor-hexan-1,3-dion |
| 1-benzo[b]thiophen-3-yl-2H,2H-heptafluoro-hexane-1,3-dione |
| 1,3-Hexanedione,1-benzo[b]thien-3-yl-4,4,5,5,6,6,6-heptafluoro |