ethyl 2-(3,3,5,5-tetranitro-1-piperidyl)acetate
Modify Date: 2025-09-09 18:50:21
ethyl 2-(3,3,5,5-tetranitro-1-piperidyl)acetate structure
|
Common Name | ethyl 2-(3,3,5,5-tetranitro-1-piperidyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 36235-44-6 | Molecular Weight | 351.22700 | |
| Density | 1.61g/cm3 | Boiling Point | 561.7ºC at 760 mmHg | |
| Molecular Formula | C9H13N5O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.5ºC | |
| Name | (3,3,5,5-tetranitropiperidin-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 561.7ºC at 760 mmHg |
| Molecular Formula | C9H13N5O10 |
| Molecular Weight | 351.22700 |
| Flash Point | 293.5ºC |
| Exact Mass | 351.06600 |
| PSA | 212.82000 |
| LogP | 0.78530 |
| Index of Refraction | 1.572 |
| InChIKey | ZXCVPZBCADFNPO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1CC([N+](=O)[O-])([N+](=O)[O-])CC([N+](=O)[O-])([N+](=O)[O-])C1 |
| HS Code | 2933399090 |
|---|
|
~%
ethyl 2-(3,3,5,... CAS#:36235-44-6 |
| Literature: Feuer et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 5124 |
|
~%
ethyl 2-(3,3,5,... CAS#:36235-44-6 |
| Literature: Feuer et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 5124 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (3,3,5,5-tetranitro-piperidino)-acetic acid ethyl ester |
| (3,3,5,5-Tetranitro-piperidino)-essigsaeure |
| 1-carboxymethyl-3,3,5,5-tetranitropiperidin |
| (3,3,5,5-tetranitro-piperidino)-acetic acid |
| (3,3,5,5-Tetranitro-piperidino)-essigsaeure-aethylester |