2-Boc-6-Hydroxy-1,2,3,4-tetrahydro-isoquinoline-1-carboxylic acid structure
|
Common Name | 2-Boc-6-Hydroxy-1,2,3,4-tetrahydro-isoquinoline-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 362492-00-0 | Molecular Weight | 293.31500 | |
| Density | 1.302g/cm3 | Boiling Point | 497.9ºC at 760mmHg | |
| Molecular Formula | C15H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.9ºC | |
| Name | 6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 497.9ºC at 760mmHg |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.31500 |
| Flash Point | 254.9ºC |
| Exact Mass | 293.12600 |
| PSA | 87.07000 |
| LogP | 2.24900 |
| Index of Refraction | 1.579 |
| InChIKey | KCDBTPOYUDNXBR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(O)ccc2C1C(=O)O |
| Storage condition | 2-8°C |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-hydroxy-3,4-dihydro-1h-isoquinoline-1,2-dicarboxylic acid 2-tert-butyl ester |
| N-(tert-butyloxycarbonyl)-6-hydroxy-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| 2-(tert-butoxycarbonyl)-6-hydroxy-1,2,3,4-tetrahydro-1-isoquinolinecarboxylic acid |
| 2-boc-6-hydroxy-3,4-dihydro-1h-isoquinoline-1-carboxylic acid |
| 2-(tert-butoxycarbonyl)-6-hydroxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| 2-Boc-6-Hydroxy-1,2,3,4-tetrahydro-isoquinoline-1-carboxylic acid |