ethyl 8-(4-methoxyphenyl)-8-oxooctanoate
ethyl 8-(4-methoxyphenyl)-8-oxooctanoate structure
|
Common Name | ethyl 8-(4-methoxyphenyl)-8-oxooctanoate | ||
|---|---|---|---|---|
| CAS Number | 362669-41-8 | Molecular Weight | 292.37000 | |
| Density | 1.042g/cm3 | Boiling Point | 411.589ºC at 760 mmHg | |
| Molecular Formula | C17H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.245ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 8-(4-methoxyphenyl)-8-oxooctanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 411.589ºC at 760 mmHg |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37000 |
| Flash Point | 179.245ºC |
| Exact Mass | 292.16700 |
| PSA | 52.60000 |
| LogP | 3.78160 |
| Index of Refraction | 1.495 |
| InChIKey | SOAKQIVMCICRIL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCCC(=O)c1ccc(OC)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2918990090 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 7-(p-anisoyl)heptanoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate? |
| A: SMILES notation of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate is CCOC(=O)CCCCCCC(=O)c1ccc(OC)cc1. |
| Q: What is the boiling point of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate? |
| A: Boiling point of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate is 411.589ºC at 760 mmHg. |
| Q: What is the molecular weight of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate? |
| A: Molecular weight of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate is 292.37000. |
| Q: What is the CAS number of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate? |
| A: CAS number of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate is 362669-41-8. |
| Q: What is the InChIKey of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate? |
| A: InChIKey of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate is SOAKQIVMCICRIL-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate? |
| A: Polar surface area (PSA) of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate is 52.60000. |
| Q: What English synonyms does ethyl 8-(4-methoxyphenyl)-8-oxooctanoate have? |
| A: English synonyms of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate: ethyl 7-(p-anisoyl)heptanoate. |
| Q: What is the English name of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate? |
| A: The English name of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate is ethyl 8-(4-methoxyphenyl)-8-oxooctanoate. |
| Q: What is the molecular formula of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate? |
| A: Molecular formula of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate is C17H24O4. |
| Q: What is the LogP of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate? |
| A: LogP of ethyl 8-(4-methoxyphenyl)-8-oxooctanoate is 3.78160. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |