ETHYL 8-(2-NAPHTHYL)-8-OXOOCTANOATE structure
|
Common Name | ETHYL 8-(2-NAPHTHYL)-8-OXOOCTANOATE | ||
|---|---|---|---|---|
| CAS Number | 362669-46-3 | Molecular Weight | 312.40300 | |
| Density | 1.074g/cm3 | Boiling Point | 453.8ºC at 760 mmHg | |
| Molecular Formula | C20H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.1ºC | |
| Name | ethyl 8-naphthalen-2-yl-8-oxooctanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 453.8ºC at 760 mmHg |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.40300 |
| Flash Point | 198.1ºC |
| Exact Mass | 312.17300 |
| PSA | 43.37000 |
| LogP | 4.92620 |
| Index of Refraction | 1.552 |
| InChIKey | JVIRNBRQQNNAKD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCCC(=O)c1ccc2ccccc2c1 |
| HS Code | 2918300090 |
|---|
|
~%
ETHYL 8-(2-NAPH... CAS#:362669-46-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 1 p. 283 - 287 |
|
~54%
ETHYL 8-(2-NAPH... CAS#:362669-46-3 |
| Literature: Delorme, Daniel; Woo, Soon Hyung; Vaisburg, Arkadii Patent: US2002/115826 A1, 2002 ; |
|
~%
ETHYL 8-(2-NAPH... CAS#:362669-46-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 45, # 13 p. 2877 - 2885 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 7-(2-naphthoyl)heptanoate |
| ETHYL 8-(2-NAPHTHYL)-8-OXOOCTANOATE |