Monascorubramine structure
|
Common Name | Monascorubramine | ||
|---|---|---|---|---|
| CAS Number | 3627-51-8 | Molecular Weight | 381.46500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MonascorubramineMonascorubramine is a microbial colorant. Monascorubramine is capable of producing by the Monascus, which is from the bacteria Talaromyces. Under the condition of different pH value, the hue and chromaticity value of the colorant are also different[1]. |
| Name | 9a-methyl-3-octanoyl-6-trans-propenyl-7H,9aH-furo[3,2-g]isoquinoline-2,9-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Monascorubramine is a microbial colorant. Monascorubramine is capable of producing by the Monascus, which is from the bacteria Talaromyces. Under the condition of different pH value, the hue and chromaticity value of the colorant are also different[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H27NO4 |
|---|---|
| Molecular Weight | 381.46500 |
| Exact Mass | 381.19400 |
| PSA | 76.23000 |
| LogP | 3.84740 |
| InChIKey | QZQXRZXYWVQWAY-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| Monascamin |
| 9a-Methyl-3-octanoyl-6-((E)-propenyl)-7H,9aH-furo[3,2-g]isoquinoline-2,9-dione |
| Monascorubramin |