6-chloro-1-methyl-4-phenylquinolin-2-one structure
|
Common Name | 6-chloro-1-methyl-4-phenylquinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 36271-04-2 | Molecular Weight | 269.72600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloro-1-methyl-4-phenylquinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12ClNO |
|---|---|
| Molecular Weight | 269.72600 |
| Exact Mass | 269.06100 |
| PSA | 22.00000 |
| LogP | 3.85890 |
| InChIKey | FQGPKTNLTWFWBW-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)cc(-c2ccccc2)c2cc(Cl)ccc21 |
|
~82%
6-chloro-1-meth... CAS#:36271-04-2
Learn More
|
| Literature: Popova; Kulikov; Piotrovskii Russian Journal of General Chemistry, 2004 , vol. 74, # 9 p. 1467 - 1468 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| 6-chloro-1-methyl-4-phenyl-1H-quinolin-2-one |
| CCG-5052 |
| N-methyl-6-chloro-4-phenyl-2-quinolone |