3-Cyclopropoxy-4-difluoromethoxy-benzaldehyde structure
|
Common Name | 3-Cyclopropoxy-4-difluoromethoxy-benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 362718-98-7 | Molecular Weight | 228.19200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-cyclopropyloxy-4-(difluoromethoxy)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10F2O3 |
|---|---|
| Molecular Weight | 228.19200 |
| Exact Mass | 228.06000 |
| PSA | 35.53000 |
| LogP | 2.64170 |
| InChIKey | QQIQCVYBOCMZBR-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(OC(F)F)c(OC2CC2)c1 |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 3-Cyclopropoxy-4-difluoromethoxy-benzaldehyde |
| Benzaldehyde,3-(cyclopropyloxy)-4-(difluoromethoxy) |
| 3-cyclopropyloxy-4-difluoromethoxybenzaldehyde |