2'-Brom-4'-fluor-2-phenylacetophenon
Modify Date: 2026-06-30 11:26:22
2'-Brom-4'-fluor-2-phenylacetophenon structure
|
Common Name | 2'-Brom-4'-fluor-2-phenylacetophenon | ||
|---|---|---|---|---|
| CAS Number | 36282-27-6 | Molecular Weight | 293.13100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10BrFO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2'-Brom-4'-fluor-2-phenylacetophenon |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10BrFO |
|---|---|
| Molecular Weight | 293.13100 |
| Exact Mass | 291.99000 |
| PSA | 17.07000 |
| LogP | 4.01360 |
| InChIKey | HXNOSKFQSAIYHN-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccccc1)c1ccc(F)cc1Br |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:61547-74-8![[5-fluoro-2-(1,1,2,2-tetrafluoro-2-phenylethyl)phenyl]methanamine structure](https://image.chemsrc.com/caspic/342/61547-76-0.png)
CAS#:61547-76-0This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2'-Brom-4'-fluor-2-phenylacetophenon? |
| A: LogP of 2'-Brom-4'-fluor-2-phenylacetophenon is 4.01360. |
| Q: What is the polar surface area (PSA) of 2'-Brom-4'-fluor-2-phenylacetophenon? |
| A: Polar surface area (PSA) of 2'-Brom-4'-fluor-2-phenylacetophenon is 17.07000. |
| Q: What is the molecular weight of 2'-Brom-4'-fluor-2-phenylacetophenon? |
| A: Molecular weight of 2'-Brom-4'-fluor-2-phenylacetophenon is 293.13100. |
| Q: What is the SMILES notation of 2'-Brom-4'-fluor-2-phenylacetophenon? |
| A: SMILES notation of 2'-Brom-4'-fluor-2-phenylacetophenon is O=C(Cc1ccccc1)c1ccc(F)cc1Br. |
| Q: What is the InChIKey of 2'-Brom-4'-fluor-2-phenylacetophenon? |
| A: InChIKey of 2'-Brom-4'-fluor-2-phenylacetophenon is HXNOSKFQSAIYHN-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2'-Brom-4'-fluor-2-phenylacetophenon? |
| A: CAS number of 2'-Brom-4'-fluor-2-phenylacetophenon is 36282-27-6. |
| Q: What is the English name of 2'-Brom-4'-fluor-2-phenylacetophenon? |
| A: The English name of 2'-Brom-4'-fluor-2-phenylacetophenon is 2'-Brom-4'-fluor-2-phenylacetophenon. |
| Q: What is the Chinese name of 36282-27-6? |
| A: Chinese name of 36282-27-6 is 36282-27-6. |
| Q: What is the molecular formula of 2'-Brom-4'-fluor-2-phenylacetophenon? |
| A: Molecular formula of 2'-Brom-4'-fluor-2-phenylacetophenon is C14H10BrFO. |
| Q: What are the downstream products of 2'-Brom-4'-fluor-2-phenylacetophenon? |
| A: Related downstream products(CAS) of 2'-Brom-4'-fluor-2-phenylacetophenon: 61547-74-8;61547-76-0. |