N-(3-chlorophenyl)-3,5-dinitrobenzamide
Modify Date: 2025-09-13 18:22:09
N-(3-chlorophenyl)-3,5-dinitrobenzamide structure
|
Common Name | N-(3-chlorophenyl)-3,5-dinitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 36293-16-0 | Molecular Weight | 321.67300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-chlorophenyl)-3,5-dinitrobenzamide |
|---|
| Molecular Formula | C13H8ClN3O5 |
|---|---|
| Molecular Weight | 321.67300 |
| Exact Mass | 321.01500 |
| PSA | 120.74000 |
| LogP | 4.52810 |
| InChIKey | WSDHQVWNYXYMCJ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
|
Name: Inhibition of human 5-LOX using arachidonic acid as substrate preincubated for 10 min...
Source: ChEMBL
Target: Polyunsaturated fatty acid 5-lipoxygenase
External Id: CHEMBL3240356
|
|
Name: Inhibition of 5-LOX in human whole blood assessed as inhibition of A23187-induced LTB...
Source: ChEMBL
Target: Polyunsaturated fatty acid 5-lipoxygenase
External Id: CHEMBL3240357
|
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 3, Current Page 1 of 1
1