Tricetamide structure
|
Common Name | Tricetamide | ||
|---|---|---|---|---|
| CAS Number | 363-20-2 | Molecular Weight | 324.37200 | |
| Density | 1.123g/cm3 | Boiling Point | 440.4ºC at 760 mmHg | |
| Molecular Formula | C16H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | N-[2-(Diethylamino)-2-oxoethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 440.4ºC at 760 mmHg |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.37200 |
| Flash Point | 220.1ºC |
| Exact Mass | 324.16900 |
| PSA | 80.59000 |
| LogP | 1.88540 |
| Index of Refraction | 1.513 |
| InChIKey | NLRFFZRHTICQBO-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)CNC(=O)c1cc(OC)c(OC)c(OC)c1 |
| HS Code | 2924299090 |
|---|
|
~%
Tricetamide CAS#:363-20-2 |
| Literature: Roehnert,H. Archiv der Pharmazie und Berichte der Deutschen Pharmazeutischen Gesellschaft, 1960 , vol. 293, p. 573 - 576 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-((Diethylcarbamoyl)methyl)-3,4,5-trimethoxybenzamide |
| Trimethobenzglycin |
| N-(3,4,5-Trimethoxy-benzoyl)-glycin-diaethylamid |
| Tricetamide |
| R-548 |
| 3,4,5-Trimethoxy-benzoyl-glycindiethylamid |
| N-(3,4,5-trimethoxy-benzoyl)-glycine diethylamide |
| Riker 548 |
| Tricetamide [USAN] |
| Trimeglamide |