calcium di-beta-alaninate structure
|
Common Name | calcium di-beta-alaninate | ||
|---|---|---|---|---|
| CAS Number | 36321-40-1 | Molecular Weight | 216.24800 | |
| Density | 1.166g/cm3 | Boiling Point | 237.1ºC at 760mmHg | |
| Molecular Formula | C6H12CaN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.2ºC | |
| Name | calcium,3-aminopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 237.1ºC at 760mmHg |
| Molecular Formula | C6H12CaN2O4 |
| Molecular Weight | 216.24800 |
| Flash Point | 97.2ºC |
| Exact Mass | 216.04200 |
| PSA | 132.30000 |
| InChIKey | QRTVQUYKMVAQBJ-UHFFFAOYSA-L |
| SMILES | NCCC(=O)[O-].NCCC(=O)[O-].[Ca+2] |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| calcium bis(3-aminopropanoate) |
| calcium 3-aminopropanoate |
| calcium salt of B-Alanine |
| b-Alanine,calcium salt (2:1) |