Benzenesulfonic acid,4-methyl-, 2-(2-thienylmethylene)hydrazide
Benzenesulfonic acid,4-methyl-, 2-(2-thienylmethylene)hydrazide structure
|
Common Name | Benzenesulfonic acid,4-methyl-, 2-(2-thienylmethylene)hydrazide | ||
|---|---|---|---|---|
| CAS Number | 36331-49-4 | Molecular Weight | 280.36600 | |
| Density | 1.32g/cm3 | Boiling Point | 440.8ºC at 760 mmHg | |
| Molecular Formula | C12H12N2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 440.8ºC at 760 mmHg |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.36600 |
| Flash Point | 220.4ºC |
| Exact Mass | 280.03400 |
| PSA | 95.15000 |
| LogP | 3.84060 |
| Index of Refraction | 1.637 |
| InChIKey | PMRVBPJVOSPFOE-UKTHLTGXSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=Cc2cccs2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~88%
Benzenesulfonic... CAS#:36331-49-4 |
| Literature: Liu, Ping; Xu, Qian-Qian; Dong, Chao; Lei, Xinsheng; Lin, Guo-Qiang Synlett, 2012 , vol. 23, # 14 p. 2087 - 2092 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 3 | |
CAS#:4861-58-9
CAS#:2026-42-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-thiophenecarboxaldehyde tosylhydrazone |
| thiophene 2-carboxaldehyde toluene-p-sulphonylhydrazone |
| thiophene-2-carbaldehyde (toluene-4-sulfonyl)-hydrazone |
| 2-thiophenecarbaldehyde tosylhydrazone |
| 4-methyl-N'-(thien-2-ylmethylene)benzenesulfonohydrazide |
| thiophene-2-aldehyde tosylhydrazone |
| thiophene-2-carboxaldehyde tosylhydrazone |
| N'1-(2-thienylmethylidene)-4-methylbenzene-1-sulfonohydrazide |
| 4-methyl-N'-(thiophen-2-ylmethylene)benzenesulfonohydrazide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide? |
| A: InChIKey of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide is PMRVBPJVOSPFOE-UKTHLTGXSA-N. |
| Q: What is the polar surface area (PSA) of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide? |
| A: Polar surface area (PSA) of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide is 95.15000. |
| Q: What is the English name of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide? |
| A: The English name of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide is 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide. |
| Q: What is the boiling point of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide? |
| A: Boiling point of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide is 440.8ºC at 760 mmHg. |
| Q: What are the downstream products of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide? |
| A: Related downstream products(CAS) of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide: 4861-58-9;98-03-3;2026-42-8. |
| Q: What is the molecular weight of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide? |
| A: Molecular weight of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide is 280.36600. |
| Q: What is the LogP of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide? |
| A: LogP of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide is 3.84060. |
| Q: What are the upstream materials of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide? |
| A: Related upstream materials(CAS) of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide: 98-03-3;1576-35-8. |
| Q: What is the Chinese name of 36331-49-4? |
| A: Chinese name of 36331-49-4 is 36331-49-4. |
| Q: What is the molecular formula of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide? |
| A: Molecular formula of 4-methyl-N-[(E)-thiophen-2-ylmethylideneamino]benzenesulfonamide is C12H12N2O2S2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |