Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate
Modify Date: 2026-08-03 17:12:13
![Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate Structure](https://www.chemsrc.com/extcaspic/418/36331-92-7.png)
Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate structure
|
Common Name | Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 36331-92-7 | Molecular Weight | 221.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H19NO2 |
|---|---|
| Molecular Weight | 221.29 |
| InChIKey | KNYCJWGNRRJERQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(C#N)CC2(CCCCC2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate? |
| A: SMILES notation of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate is CCOC(=O)C1(C#N)CC2(CCCCC2)C1. |
| Q: What is the molecular formula of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate? |
| A: Molecular formula of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate is C13H19NO2. |
| Q: What is the InChIKey of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate? |
| A: InChIKey of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate is KNYCJWGNRRJERQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate? |
| A: CAS number of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate is 36331-92-7. |
| Q: What is the Chinese name of 36331-92-7? |
| A: Chinese name of 36331-92-7 is 36331-92-7. |
| Q: What is the molecular weight of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate? |
| A: Molecular weight of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate is 221.29. |
| Q: What is the English name of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate? |
| A: The English name of Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate is Ethyl 2-cyanospiro[3.5]nonane-2-carboxylate. |