Germane, tetrapentyl- structure
|
Common Name | Germane, tetrapentyl- | ||
|---|---|---|---|---|
| CAS Number | 3634-47-7 | Molecular Weight | 357.20300 | |
| Density | N/A | Boiling Point | 173ºC 4mm | |
| Molecular Formula | C20H44Ge | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.3ºC | |
| Name | tetrapentylgermane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 173ºC 4mm |
|---|---|
| Molecular Formula | C20H44Ge |
| Molecular Weight | 357.20300 |
| Flash Point | 185.3ºC |
| Exact Mass | 358.26500 |
| LogP | 8.19600 |
| InChIKey | PVVOYYQNPQNKGU-UHFFFAOYSA-N |
| SMILES | CCCCC[Ge](CCCCC)(CCCCC)CCCCC |
| HS Code | 2931900090 |
|---|
|
~%
Germane, tetrap... CAS#:3634-47-7 |
| Literature: Lesbre et al. Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1955 , vol. 240, p. 622,623 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| tetrapentyl germane |
| Tetra-n-pentylgerman |
| EINECS 222-850-3 |
| Tetra-n-pentyl-germanium |
| Tetrapentyl-german |
| Germane,tetrapentyl |
| Tetrapentylgermanium |