2(1H)-Pyrazinone,6-methyl-, 4-oxide structure
|
Common Name | 2(1H)-Pyrazinone,6-methyl-, 4-oxide | ||
|---|---|---|---|---|
| CAS Number | 36341-34-1 | Molecular Weight | 126.11300 | |
| Density | 1.26g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-4-oxido-1H-pyrazin-4-ium-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Molecular Formula | C5H6N2O2 |
| Molecular Weight | 126.11300 |
| Exact Mass | 126.04300 |
| PSA | 58.32000 |
| LogP | 0.11180 |
| Index of Refraction | 1.561 |
| InChIKey | LOJAOASAMFAOQU-UHFFFAOYSA-N |
| SMILES | Cc1c[n+]([O-])cc(=O)[nH]1 |
|
~66%
2(1H)-Pyrazinon... CAS#:36341-34-1 |
| Literature: Mano; Seo; Hattori; Kaneko; Imai Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 9 p. 2734 - 2747 |
|
~%
2(1H)-Pyrazinon... CAS#:36341-34-1 |
| Literature: Mano; Seo; Hattori; Kaneko; Imai Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 9 p. 2734 - 2747 |
|
~%
2(1H)-Pyrazinon... CAS#:36341-34-1 |
| Literature: Mano; Seo; Imai Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 9 p. 2720 - 2733 |
| 6-methylpyrazin-2(1h)-one 4-oxide |
| 6-methyl-4-oxy-1H-pyrazin-2-one |
| 1,2-Dihydro-2-oxo-6-methylpyrazine-4-oxide |
| 2(1H)-Pyrazinone,6-methyl-,4-oxide |
| 6-methyl-2(1H)-pyrazinone 4-oxide |