N-[(Benzyloxy)carbonyl]-3-fluoroalanine structure
|
Common Name | N-[(Benzyloxy)carbonyl]-3-fluoroalanine | ||
|---|---|---|---|---|
| CAS Number | 36369-34-3 | Molecular Weight | 241.216 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 442.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H12FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.6±28.7 °C | |
| Name | (R)-2-(((Benzyloxy)carbonyl)amino)-3-fluoropropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 442.8±45.0 °C at 760 mmHg |
| Molecular Formula | C11H12FNO4 |
| Molecular Weight | 241.216 |
| Flash Point | 221.6±28.7 °C |
| Exact Mass | 241.075043 |
| PSA | 79.12000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | FXFJJOJQOPXMPP-VIFPVBQESA-N |
| SMILES | O=C(NC(CF)C(=O)O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~94%
N-[(Benzyloxy)c... CAS#:36369-34-3 |
| Literature: Hoveyda, Hamid R.; Pinault, Jean-Francois Organic Letters, 2006 , vol. 8, # 25 p. 5849 - 5852 |
|
~%
N-[(Benzyloxy)c... CAS#:36369-34-3 |
| Literature: Hoffmann-La Roche Inc. Patent: US4143134 A1, 1979 ; |
|
~%
N-[(Benzyloxy)c... CAS#:36369-34-3 |
| Literature: Hoveyda, Hamid R.; Pinault, Jean-Francois Organic Letters, 2006 , vol. 8, # 25 p. 5849 - 5852 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Alanine, 3-fluoro-N-[(phenylmethoxy)carbonyl]- |
| N-[(Benzyloxy)carbonyl]-3-fluoroalanine |