4-(4-oxonaphthalen-1-ylidene)naphthalen-1-one
Modify Date: 2025-08-20 11:06:39
4-(4-oxonaphthalen-1-ylidene)naphthalen-1-one structure
|
Common Name | 4-(4-oxonaphthalen-1-ylidene)naphthalen-1-one | ||
|---|---|---|---|---|
| CAS Number | 36378-06-0 | Molecular Weight | 284.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-oxonaphthalen-1-ylidene)naphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H12O2 |
|---|---|
| Molecular Weight | 284.30800 |
| Exact Mass | 284.08400 |
| PSA | 34.14000 |
| LogP | 4.10240 |
| InChIKey | OZFQBVVTWVNACH-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=C2C=CC(=O)c3ccccc32)c2ccccc21 |
|
~3%
4-(4-oxonaphtha... CAS#:36378-06-0
Detail
|
| Literature: Kashiwagi, Yoshitomo; Ono, Hiroaki; Osa, Tetsuo Chemistry Letters, 1993 , # 1 p. 81 - 84 |
|
~%
4-(4-oxonaphtha... CAS#:36378-06-0 |
| Literature: Edwards; Cashaw Journal of the American Chemical Society, 1954 , vol. 76, p. 6141 |
![4,4'-Bi[1-naphthol] structure](https://image.chemsrc.com/caspic/448/1446-34-0.png)
![[2,2'-Binaphthalene]-1,1'-diol structure](https://image.chemsrc.com/caspic/392/604-60-4.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| [1,1']Binaphthyliden-4,4'-dion |
| 1(4H)-Naphthalenone,4-(4-oxo-1(4H)-naphthalenylidene) |
| [1,1']binaphthylidene-4,4'-dione |