methyl 9-oxido-8-oxa-7-aza-9-azoniabicyclo[4.3.0]nona-2,4,6,9-tetraene-4-carboxylate structure
|
Common Name | methyl 9-oxido-8-oxa-7-aza-9-azoniabicyclo[4.3.0]nona-2,4,6,9-tetraene-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 36389-06-7 | Molecular Weight | 194.14400 | |
| Density | 1.53g/cm3 | Boiling Point | 325.5ºC at 760 mmHg | |
| Molecular Formula | C8H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.7ºC | |
| Name | methyl 1-oxido-2,1,3-benzoxadiazol-1-ium-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 325.5ºC at 760 mmHg |
| Molecular Formula | C8H6N2O4 |
| Molecular Weight | 194.14400 |
| Flash Point | 150.7ºC |
| Exact Mass | 194.03300 |
| PSA | 77.79000 |
| LogP | 1.04290 |
| Index of Refraction | 1.64 |
| InChIKey | RNWZDPNHUZUYQZ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(c1)no[n+]2[O-] |
| HS Code | 2934999090 |
|---|
|
~%
methyl 9-oxido-... CAS#:36389-06-7 |
| Literature: Ghosh; Ternai; Whitehouse Journal of medicinal chemistry, 1972 , vol. 15, # 3 p. 255 - 260 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 2,1,3-benzoxadiazole-5-carboxylate 1-oxide |
| 5-Methoxycarbonylbenzofuroxan |
| 1-oxy-benzo[1,2,5]oxadiazole-5-carboxylic acid methyl ester |