[4-[2-(4-arsonoanilino)ethylamino]phenyl]arsonic acid structure
|
Common Name | [4-[2-(4-arsonoanilino)ethylamino]phenyl]arsonic acid | ||
|---|---|---|---|---|
| CAS Number | 3639-19-8 | Molecular Weight | 460.14600 | |
| Density | N/A | Boiling Point | 870.1ºC at 760 mmHg | |
| Molecular Formula | C14H18As2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 480ºC | |
| Name | [4-[2-(4-arsonoanilino)ethylamino]phenyl]arsonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 870.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C14H18As2N2O6 |
| Molecular Weight | 460.14600 |
| Flash Point | 480ºC |
| Exact Mass | 459.96000 |
| PSA | 139.12000 |
| InChIKey | YQVALJGIKVYRNI-UHFFFAOYSA-N |
| SMILES | O=[As](O)(O)c1ccc(NCCNc2ccc([As](=O)(O)O)cc2)cc1 |
| HS Code | 2931900090 |
|---|
|
~%
[4-[2-(4-arsono... CAS#:3639-19-8 |
| Literature: Hamilton Journal of the American Chemical Society, 1923 , vol. 45, p. 2752 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| N.N'-Aethylendiarsanilsaeure |
| Difetarsone |
| Difetarsona |
| Diphetarsone |
| Diphetarson |
| Difetarsonum |