7-[(E)-7-hydroxy-3,7-dimethyl-6-oxo-oct-2-enoxy]chromen-2-one structure
|
Common Name | 7-[(E)-7-hydroxy-3,7-dimethyl-6-oxo-oct-2-enoxy]chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 36413-96-4 | Molecular Weight | 330.37500 | |
| Density | 1.189g/cm3 | Boiling Point | 543.5ºC at 760 mmHg | |
| Molecular Formula | C19H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-[(E)-7-hydroxy-3,7-dimethyl-6-oxooct-2-enoxy]chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 543.5ºC at 760 mmHg |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.37500 |
| Exact Mass | 330.14700 |
| PSA | 76.74000 |
| LogP | 3.23830 |
| Index of Refraction | 1.558 |
| InChIKey | YSRYKTUWDVLRLA-JLHYYAGUSA-N |
| SMILES | CC(=CCOc1ccc2ccc(=O)oc2c1)CCC(=O)C(C)(C)O |
|
~78%
7-[(E)-7-hydrox... CAS#:36413-96-4 |
| Literature: Edegger, Klaus; Mayer, Sandra F.; Steinreiber, Andreas; Faber, Kurt Tetrahedron, 2004 , vol. 60, # 3 p. 583 - 588 |
|
~6%
7-[(E)-7-hydrox... CAS#:36413-96-4 |
| Literature: Yamada, Yasumasa; Kikuzaki, Hiroe; Nakatani, Nobuji Bioscience, Biotechnology, and Biochemistry, 1992 , vol. 56, # 1 p. 153 - 154 |
|
~%
7-[(E)-7-hydrox... CAS#:36413-96-4 |
| Literature: Edegger, Klaus; Mayer, Sandra F.; Steinreiber, Andreas; Faber, Kurt Tetrahedron, 2004 , vol. 60, # 3 p. 583 - 588 |
|
~%
7-[(E)-7-hydrox... CAS#:36413-96-4 |
| Literature: Edegger, Klaus; Mayer, Sandra F.; Steinreiber, Andreas; Faber, Kurt Tetrahedron, 2004 , vol. 60, # 3 p. 583 - 588 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 7-(6'-oxo-7'-hydroxy-3',7'-dimethyl-2'-octenyloxy)coumarin |
| 7-(7-hydroxy-3,7-dimethyl-6-oxooct-2E-enyloxy)chromen-2-one |
| 6'-dehydromarmin |
| Dehydromarmin |