diethyl 2,6-dimethyl-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyridine-3,5-dicarboxylate structure
|
Common Name | diethyl 2,6-dimethyl-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyridine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 36422-60-3 | Molecular Weight | 419.46800 | |
| Density | 1.147g/cm3 | Boiling Point | 520.3ºC at 760 mmHg | |
| Molecular Formula | C22H29NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.5ºC | |
| Name | diethyl 2,6-dimethyl-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147g/cm3 |
|---|---|
| Boiling Point | 520.3ºC at 760 mmHg |
| Molecular Formula | C22H29NO7 |
| Molecular Weight | 419.46800 |
| Flash Point | 268.5ºC |
| Exact Mass | 419.19400 |
| PSA | 92.32000 |
| LogP | 3.40220 |
| Index of Refraction | 1.517 |
| InChIKey | JRPLEVHPTJLZEV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1c1cc(OC)c(OC)c(OC)c1 |
|
~93%
diethyl 2,6-dim... CAS#:36422-60-3 |
| Literature: Datta, Bandita; Pasha, M. Afzal Chinese Journal of Catalysis, 2011 , vol. 32, # 6-8 p. 1180 - 1184 |
|
~82%
diethyl 2,6-dim... CAS#:36422-60-3 |
| Literature: Murthy; Rajack, Abdul; Taraka Ramji; Jeson Babu; Praveen, Ch.; Aruna Lakshmi Bioorganic and Medicinal Chemistry Letters, 2012 , vol. 22, # 18 p. 6016 - 6023 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| diethyl 4-(3,4,5-trimethoxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| 2,6-dimethyl-3,5-dicarboethoxy-4-(3,4,5-trimethoxyphenyl)-1,4-dihydropyridine |