Tributyl(4-nitrophenoxy)stannane structure
|
Common Name | Tributyl(4-nitrophenoxy)stannane | ||
|---|---|---|---|---|
| CAS Number | 3644-32-4 | Molecular Weight | 428.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H31NO3Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributyl-(4-nitrophenoxy)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H31NO3Sn |
|---|---|
| Molecular Weight | 428.14500 |
| Exact Mass | 429.13300 |
| PSA | 68.88000 |
| LogP | 6.74280 |
| InChIKey | SWZPSYJFHVBDSY-UHFFFAOYSA-M |
| SMILES | CCCC[Sn](CCCC)(CCCC)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| p-Nitrophenoxytributyltin |
| Tin,tributyl(p-nitrophenoxy) |
| Stannane,(p-nitrophenoxy)tributyl |
| Tributytin 4-nitrophenoxide |
| Stannane,tributyl(4-nitrophenoxy) |
| (p-Nitrophenoxy)triphenylstannane |
| Stannane,tributyl(4-nitrophenoxy)-(9CI) |