1,3-Benzenedicarboxylic acid, bis(2-hydroxyethyl) ester structure
|
Common Name | 1,3-Benzenedicarboxylic acid, bis(2-hydroxyethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 3644-99-3 | Molecular Weight | 254.23600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2-hydroxyethyl) benzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O6 |
|---|---|
| Molecular Weight | 254.23600 |
| Exact Mass | 254.07900 |
| PSA | 93.06000 |
| InChIKey | ULCGAWLDXLEIIR-UHFFFAOYSA-N |
| SMILES | O=C(OCCO)c1cccc(C(=O)OCCO)c1 |
| HS Code | 2918199090 |
|---|
|
~%
1,3-Benzenedica... CAS#:3644-99-3 |
| Literature: Lyon, Robert P.; Atkins, William M.; Maeda, Dean Y.; Zebala, John A. Patent: US2005/4038 A1, 2005 ; Location in patent: Page/Page column 17 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Isophthalsaeure-di-(2-hydroxyethyl)-ester |
| 1,3-Benzenedicarboxylic acid,bis(2-hydroxyethyl) ester |
| bis-ethanolisophthalate |