3-(1-benzyl-2-oxo-cyclopentyl)propanoic acid structure
|
Common Name | 3-(1-benzyl-2-oxo-cyclopentyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 3645-83-8 | Molecular Weight | 246.30200 | |
| Density | 1.169g/cm3 | Boiling Point | 426.4ºC at 760mmHg | |
| Molecular Formula | C15H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.8ºC | |
| Name | 3-(1-benzyl-2-oxocyclopentyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 426.4ºC at 760mmHg |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.30200 |
| Flash Point | 225.8ºC |
| Exact Mass | 246.12600 |
| PSA | 54.37000 |
| LogP | 2.83330 |
| Index of Refraction | 1.556 |
| InChIKey | IYXKLVYOMAMWSK-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC1(Cc2ccccc2)CCCC1=O |
| HS Code | 2918300090 |
|---|
|
~%
3-(1-benzyl-2-o... CAS#:3645-83-8 |
| Literature: Fusco,R. et al. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 393 - 407 |
|
~%
3-(1-benzyl-2-o... CAS#:3645-83-8 |
| Literature: Fusco,R. et al. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 393 - 407 |
|
~%
3-(1-benzyl-2-o... CAS#:3645-83-8 |
| Literature: Fusco,R. et al. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 393 - 407 |
|
~%
3-(1-benzyl-2-o... CAS#:3645-83-8 |
| Literature: Fusco,R. et al. Farmaco, Edizione Scientifica, 1965 , vol. 20, p. 393 - 407 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Oxo-1-benzylcyclopentylpropionsaeure |
| 1-Benzyl-2-oxocyclopentanepropionic acid |
| Cyclopentanepropionic acid,1-benzyl-2-oxo |
| 3-(1-Benzyl-2-oxo-cyclopentyl)-propionsaeure |