4-bromo-2-[[(1-ethylbenzimidazol-2-yl)amino]methyl]phenol structure
|
Common Name | 4-bromo-2-[[(1-ethylbenzimidazol-2-yl)amino]methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 364748-24-3 | Molecular Weight | 346.22200 | |
| Density | 1.48g/cm3 | Boiling Point | 523.5ºC at 760 mmHg | |
| Molecular Formula | C16H16BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.4ºC | |
| Name | 4-bromo-2-[[(1-ethylbenzimidazol-2-yl)amino]methyl]phenol |
|---|
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 523.5ºC at 760 mmHg |
| Molecular Formula | C16H16BrN3O |
| Molecular Weight | 346.22200 |
| Flash Point | 270.4ºC |
| Exact Mass | 345.04800 |
| PSA | 50.08000 |
| LogP | 4.20940 |
| Index of Refraction | 1.665 |
| InChIKey | GUVFPFMXZFAHAM-UHFFFAOYSA-N |
| SMILES | CCn1c(NCc2cc(Br)ccc2O)nc2ccccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |