tributyl(propyl)azanium,bromide structure
|
Common Name | tributyl(propyl)azanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 36477-16-4 | Molecular Weight | 308.34100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H34BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributyl(propyl)azanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H34BrN |
|---|---|
| Molecular Weight | 308.34100 |
| Exact Mass | 307.18700 |
| LogP | 1.61750 |
| InChIKey | DTZCGVKNUQJZGX-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCC)(CCCC)CCCC.[Br-] |
|
~%
tributyl(propyl... CAS#:36477-16-4 |
| Literature: Kotlyarevskii,I.L.; Tkacheva,N.A. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1974 , vol. 23, p. 2721 - 2722 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1974 , vol. 23, p. 2820 - 2821 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Propyl-tri-n-butylammoniumbromid |
| 1-Butanaminium,N,N-dibutyl-N-propyl-,bromide |
| Propyl-tributylammoniumbromid |
| Tributyl-propyl-ammoniumbromid |