(Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide
Modify Date: 2025-11-06 17:31:41
(Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide structure
|
Common Name | (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 364770-61-6 | Molecular Weight | 345.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H14Cl2N2O |
|---|---|
| Molecular Weight | 345.2 |
| InChIKey | DKKKTQHCYCKKAB-GDNBJRDFSA-N |
| SMILES | CC(NC(=O)C(C#N)=Cc1cccc(Cl)c1Cl)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide? |
| A: CAS number of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide is 364770-61-6. |
| Q: What is the molecular weight of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide? |
| A: Molecular weight of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide is 345.2. |
| Q: What is the Chinese name of 364770-61-6? |
| A: Chinese name of 364770-61-6 is 364770-61-6. |
| Q: What is the SMILES notation of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide? |
| A: SMILES notation of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide is CC(NC(=O)C(C#N)=Cc1cccc(Cl)c1Cl)c1ccccc1. |
| Q: What is the InChIKey of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide? |
| A: InChIKey of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide is DKKKTQHCYCKKAB-GDNBJRDFSA-N. |
| Q: What is the molecular formula of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide? |
| A: Molecular formula of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide is C18H14Cl2N2O. |
| Q: What is the English name of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide? |
| A: The English name of (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide is (Z)-2-Cyano-3-(2,3-dichlorophenyl)-N-(1-phenylethyl)prop-2-enamide. |