2-[4-(5-Bromo-2-pyridinyl)-1-piperazinyl]ethanol structure
|
Common Name | 2-[4-(5-Bromo-2-pyridinyl)-1-piperazinyl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 364794-69-4 | Molecular Weight | 286.16800 | |
| Density | 1.451g/cm3 | Boiling Point | 424.669ºC at 760 mmHg | |
| Molecular Formula | C11H16BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.633ºC | |
| Name | 2-[4-(5-Bromo-2-pyridinyl)-1-piperazinyl]-1-ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.451g/cm3 |
|---|---|
| Boiling Point | 424.669ºC at 760 mmHg |
| Molecular Formula | C11H16BrN3O |
| Molecular Weight | 286.16800 |
| Flash Point | 210.633ºC |
| Exact Mass | 285.04800 |
| PSA | 39.60000 |
| LogP | 0.96130 |
| Index of Refraction | 1.591 |
| InChIKey | WAPIGYYBSKBDAO-UHFFFAOYSA-N |
| SMILES | OCCN1CCN(c2ccc(Br)cn2)CC1 |
| HS Code | 2933990090 |
|---|
|
~26%
2-[4-(5-Bromo-2... CAS#:364794-69-4 |
| Literature: TARGEGEN, INC. Patent: WO2006/101977 A2, 2006 ; Location in patent: Page/Page column 102 ; WO 2006/101977 A2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[4-(5-bromopyridin-2-yl)piperazin-1-yl]ethanol |