4-(4-CHLORO-PHENYL)-TETRAHYDRO-PYRAN-4-CARBOXYLIC ACID structure
|
Common Name | 4-(4-CHLORO-PHENYL)-TETRAHYDRO-PYRAN-4-CARBOXYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 3648-57-5 | Molecular Weight | 240.683 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 395.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.7±27.9 °C | |
| Name | 4-(4-chlorophenyl)oxane-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.0±42.0 °C at 760 mmHg |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.683 |
| Flash Point | 192.7±27.9 °C |
| Exact Mass | 240.055328 |
| PSA | 46.53000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | YZVUFQFNZWNCPZ-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2ccc(Cl)cc2)CCOCC1 |
| HS Code | 2932999099 |
|---|
|
~87%
4-(4-CHLORO-PHE... CAS#:3648-57-5 |
| Literature: Dainippon Sumitomo Pharma Co., Ltd. Patent: EP2060563 A1, 2009 ; Location in patent: Page/Page column 19 ; |
|
~%
4-(4-CHLORO-PHE... CAS#:3648-57-5 |
| Literature: Aquila, Brian M.; Bannister, Thomas D.; Cuny, Gregory D.; Hauske, James R.; Holland, Joanne M.; Persons, Paul E.; Radeke, Heike; Wang, Fengjiang; Shao, Liming Patent: US2003/50309 A1, 2003 ; US 20030050309 A1 |
|
~%
4-(4-CHLORO-PHE... CAS#:3648-57-5 |
| Literature: Cuny, Gregory D.; Hauske, James R.; Heffernan, Michele L.R.; Holland, Joanne M.; Persons, Paul E.; Radeke, Heike Patent: US2003/105071 A1, 2003 ; US 20030105071 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2H-Pyran-4-carboxylic acid, 4-(4-chlorophenyl)tetrahydro- |
| 4-(4-Chlorophenyl)tetrahydro-2H-pyran-4-carboxylic acid |