13-EPITORULOSOL structure
|
Common Name | 13-EPITORULOSOL | ||
|---|---|---|---|---|
| CAS Number | 3650-30-4 | Molecular Weight | 306.48300 | |
| Density | 0.99g/cm3 | Boiling Point | 409.1ºC at 760 mmHg | |
| Molecular Formula | C20H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.3ºC | |
| Name | (3S)-5-[(5S,8aR)-5-(Hydroxymethyl)-5,8a-dimethyl-2-methylenedecah ydro-1-naphthalenyl]-3-methyl-1-penten-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 409.1ºC at 760 mmHg |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.48300 |
| Flash Point | 176.3ºC |
| Exact Mass | 306.25600 |
| PSA | 40.46000 |
| LogP | 4.47480 |
| Index of Refraction | 1.515 |
| InChIKey | IERFAZQCIAZODG-CENDIDJXSA-N |
| SMILES | C=CC(C)(O)CCC1C(=C)CCC2C(C)(CO)CCCC12C |
| Prost-13-en-1-oic acid,11,16-dihydroxy-16-methyl-9-oxo-,methyl ester,(11beta,13E)-(+/-) |
| epitorulosol |
| 13E)-(+-)-11,16-dihydroxy-16-methyl-9-oxaprost-13-en-1-ic acid methyl ester |
| 13-Epitorulosol |
| (13S)-Labda-8(14),15-dien-13,19-diol |
| 11-Epimisoprostol |
| Mixture of methyl 7-((1RS,2RS,3SR)-3-hydroxy-2-((1E,4RS)-4-hydroxy-4-methyloct-1-enyl)-5-oxocyclopentyl)heptanoate and methyl 7-((1RS,2RS,3SR)-3-hydroxy-2-((1E,4SR)-4-hydroxy-4-methyloct-1-enyl)-5-oxocyclopentyl)heptanoate |
| Misoprostol impurity E [EP] |
| methyl 11R,16S-dihydroxy-16-methyl-9-oxoprost-13E-en-1-oate |