benzydamine N-oxide structure
|
Common Name | benzydamine N-oxide | ||
|---|---|---|---|---|
| CAS Number | 36504-71-9 | Molecular Weight | 122.14500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of benzydamine N-oxideBenzydamine N-Oxide is a metabolite of Benzydamine. Benzydamine N-Oxide can be used to measure flavin-containing monooxygenase activity[1][2]. |
| Name | 3-(1-benzylindazol-3-yl)oxy-N,N-dimethylpropan-1-amine oxide |
|---|---|
| Synonym | More Synonyms |
| Description | Benzydamine N-Oxide is a metabolite of Benzydamine. Benzydamine N-Oxide can be used to measure flavin-containing monooxygenase activity[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C7H8NO |
|---|---|
| Molecular Weight | 122.14500 |
| Exact Mass | 122.06100 |
| PSA | 40.92000 |
| LogP | 2.16720 |
| InChIKey | VHKKEFPZHPEYJK-UHFFFAOYSA-N |
| SMILES | C[N+](C)([O-])CCCOc1nn(Cc2ccccc2)c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
benzydamine N-oxide CAS#:36504-71-9 |
| Literature: Xenobiotica, , vol. 32, # 1 p. 73 - 86 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Benzyl-3-(3-dimethylaminopropoxy)-1H-indazol-N-oxid |
| N,N-Dimethyl-3-[[1-(phenylmethyl)-1H-indazol-3-yl]oxy]-1-propanamine |
| [3-(1-benzyl-1H-indazol-3-yloxy)-propyl]-dimethyl-amine oxide |
| BenzydamineN-oxide |