1,2-dihydropyridazine-3,6-dione, compound with diethylamine (1:1) structure
|
Common Name | 1,2-dihydropyridazine-3,6-dione, compound with diethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 36518-59-9 | Molecular Weight | 185.22400 | |
| Density | N/A | Boiling Point | 284.7ºC at 760 mmHg | |
| Molecular Formula | C8H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.9ºC | |
| Name | 1,2-dihydropyridazine-3,6-dione,N-ethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 284.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.22400 |
| Flash Point | 112.9ºC |
| Exact Mass | 185.11600 |
| PSA | 78.27000 |
| LogP | 0.89450 |
| InChIKey | KAZGUEXLRUBBOH-UHFFFAOYSA-N |
| SMILES | CCNCC.O=c1ccc(=O)[nH][nH]1 |
| 1,2-Dihydropyridazine-3,6-dione,compound with diethylamine (1:1) |
| EINECS 253-082-7 |