6-[4-(3,3,3-Triphenylpropyl)-1-piperazinyl]-3-pyridazinamine structure
|
Common Name | 6-[4-(3,3,3-Triphenylpropyl)-1-piperazinyl]-3-pyridazinamine | ||
|---|---|---|---|---|
| CAS Number | 36524-71-7 | Molecular Weight | 449.59000 | |
| Density | 1.172g/cm3 | Boiling Point | 701.5ºC at 760 mmHg | |
| Molecular Formula | C29H31N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 378.1ºC | |
| Name | 6-[4-(3,3,3-triphenylpropyl)piperazin-1-yl]pyridazin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 701.5ºC at 760 mmHg |
| Molecular Formula | C29H31N5 |
| Molecular Weight | 449.59000 |
| Flash Point | 378.1ºC |
| Exact Mass | 449.25800 |
| PSA | 59.01000 |
| LogP | 4.53850 |
| Index of Refraction | 1.635 |
| InChIKey | XMLGEAMAMPIBRC-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N2CCN(CCC(c3ccccc3)(c3ccccc3)c3ccccc3)CC2)nn1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-[4-(3,3,3-triphenyl-propyl)-piperazin-1-yl]-pyridazin-3-ylamine |
| 6-[4-(3,3,3-Triphenylpropyl)-1-piperazinyl]-3-pyridazinamine |
| Piperazine,1-(6-amino-3-pyridazinyl)-4-(3,3,3-triphenylpropyl) |
| 1-(6-Amino-3-pyridazinyl)-4-(3,3,3-triphenylpropyl)piperazine |