CID 20775191
Modify Date: 2025-09-03 15:39:36
CID 20775191 structure
|
Common Name | CID 20775191 | ||
|---|---|---|---|---|
| CAS Number | 365564-08-5 | Molecular Weight | 277.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24BNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 20775191 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H24BNO3 |
|---|---|
| Molecular Weight | 277.17 |
| InChIKey | CPNHYZCBRJCKEV-UHFFFAOYSA-N |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)cc(N(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of CID 20775191? |
| A: Molecular formula of CID 20775191 is C15H24BNO3. |
| Q: What is the molecular weight of CID 20775191? |
| A: Molecular weight of CID 20775191 is 277.17. |
| Q: What is the CAS number of CID 20775191? |
| A: CAS number of CID 20775191 is 365564-08-5. |
| Q: What is the SMILES notation of CID 20775191? |
| A: SMILES notation of CID 20775191 is COc1cc(B2OC(C)(C)C(C)(C)O2)cc(N(C)C)c1. |
| Q: What is the English name of CID 20775191? |
| A: The English name of CID 20775191 is CID 20775191. |
| Q: What is the Chinese name of 365564-08-5? |
| A: Chinese name of 365564-08-5 is 365564-08-5. |
| Q: What is the InChIKey of CID 20775191? |
| A: InChIKey of CID 20775191 is CPNHYZCBRJCKEV-UHFFFAOYSA-N. |