9-Octadecenoic acid(9Z)-, 2-ethoxy-2-oxoethyl ester structure
|
Common Name | 9-Octadecenoic acid(9Z)-, 2-ethoxy-2-oxoethyl ester | ||
|---|---|---|---|---|
| CAS Number | 36557-00-3 | Molecular Weight | 368.55100 | |
| Density | 0.939g/cm3 | Boiling Point | 446ºC at 760 mmHg | |
| Molecular Formula | C22H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209ºC | |
| Name | (2-ethoxy-2-oxoethyl) (E)-octadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.939g/cm3 |
|---|---|
| Boiling Point | 446ºC at 760 mmHg |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.55100 |
| Flash Point | 209ºC |
| Exact Mass | 368.29300 |
| PSA | 52.60000 |
| LogP | 6.13020 |
| Index of Refraction | 1.46 |
| InChIKey | BNYQWPMFYZPXQZ-VAWYXSNFSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(=O)OCC |
|
~%
9-Octadecenoic ... CAS#:36557-00-3 |
| Literature: Weil et al. Journal of the American Oil Chemists' Society, 1950 , vol. 27, p. 187 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Oleoyloxyessgsaeure-aethylester |
| Oleoyloxy-essigsaeure-aethylester |
| oleoyloxy-acetic acid ethyl ester |