N-[(3,5-dimethylpyrazol-4-ylidene)amino]-4-methylaniline
Modify Date: 2025-11-25 07:24:26
![N-[(3,5-dimethylpyrazol-4-ylidene)amino]-4-methylaniline Structure](https://image.chemsrc.com/caspic/424/3656-06-2.png)
N-[(3,5-dimethylpyrazol-4-ylidene)amino]-4-methylaniline structure
|
Common Name | N-[(3,5-dimethylpyrazol-4-ylidene)amino]-4-methylaniline | ||
|---|---|---|---|---|
| CAS Number | 3656-06-2 | Molecular Weight | 214.26600 | |
| Density | 1.15g/cm3 | Boiling Point | 320.9ºC at 760 mmHg | |
| Molecular Formula | C12H14N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.9ºC | |
| Name | N-[(3,5-dimethylpyrazol-4-ylidene)amino]-4-methylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 320.9ºC at 760 mmHg |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.26600 |
| Flash Point | 147.9ºC |
| Exact Mass | 214.12200 |
| PSA | 49.11000 |
| LogP | 1.55750 |
| Index of Refraction | 1.613 |
| InChIKey | UDGHOTLHRKJELE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N=Nc2c(C)n[nH]c2C)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4'-Tolylazo)-3,5-dimethyl-pyrazol |
| F 2336 |
| 1H-Pyrazole,3,5-dimethyl-4-((4-methylphenyl)azo) |
| 3,5-dimethyl-4-(p-tolylazo)pyrazole |
| Pyrazole,3,5-dimethyl-4-(p-tolylazo) |
| 4-(4'-Tolylazo)-3,5-dimethyl-pyrazol [German] |