Methyl 2-bromo-4-(2-methoxy-2-oxoethyl)thiazole-5-carboxylate
Modify Date: 2025-09-05 00:35:12
Methyl 2-bromo-4-(2-methoxy-2-oxoethyl)thiazole-5-carboxylate structure
|
Common Name | Methyl 2-bromo-4-(2-methoxy-2-oxoethyl)thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 365996-71-0 | Molecular Weight | 294.12200 | |
| Density | 1.642g/cm3 | Boiling Point | 369ºC at 760 mmHg | |
| Molecular Formula | C8H8BrNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177ºC | |
| Name | methyl 2-bromo-4-(2-methoxy-2-oxoethyl)-1,3-thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.642g/cm3 |
|---|---|
| Boiling Point | 369ºC at 760 mmHg |
| Molecular Formula | C8H8BrNO4S |
| Molecular Weight | 294.12200 |
| Flash Point | 177ºC |
| Exact Mass | 292.93600 |
| PSA | 93.73000 |
| LogP | 1.40770 |
| Index of Refraction | 1.563 |
| InChIKey | FMLBJOMKVCNUEY-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1nc(Br)sc1C(=O)OC |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Methyl 2-bromo-4-(2-methoxy-2-oxoethyl)thiazole-5-carboxylate |