1-(4-fluorophenyl)-2-(5-fluoropyridin-1-yl)ethanone structure
|
Common Name | 1-(4-fluorophenyl)-2-(5-fluoropyridin-1-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 366-65-4 | Molecular Weight | 314.12500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10BrF2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-fluorophenyl)-2-(3-fluoropyridin-1-ium-1-yl)ethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10BrF2NO |
|---|---|
| Molecular Weight | 314.12500 |
| Exact Mass | 312.99100 |
| PSA | 20.95000 |
| InChIKey | DQPADHFCPCCAHN-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1cccc(F)c1)c1ccc(F)cc1.[Br-] |
|
~%
1-(4-fluorophen... CAS#:366-65-4 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Fluor-1-(4-fluor-phenacyl)-pyridinium,Bromid |
| 3-fluoro-1-(4-fluoro-phenacyl)-pyridinium,bromide |