[2-(2,4-difluorophenoxy)acetyl] 2-(2,4-difluorophenoxy)acetate structure
|
Common Name | [2-(2,4-difluorophenoxy)acetyl] 2-(2,4-difluorophenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 366-98-3 | Molecular Weight | 358.24100 | |
| Density | 1.439g/cm3 | Boiling Point | 452.8ºC at 760 mmHg | |
| Molecular Formula | C16H10F4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.5ºC | |
| Name | [2-(2,4-difluorophenoxy)acetyl] 2-(2,4-difluorophenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 452.8ºC at 760 mmHg |
| Molecular Formula | C16H10F4O5 |
| Molecular Weight | 358.24100 |
| Flash Point | 219.5ºC |
| Exact Mass | 358.04600 |
| PSA | 61.83000 |
| LogP | 2.77060 |
| Index of Refraction | 1.513 |
| InChIKey | KMXRCDPGKJHNMY-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(F)cc1F)OC(=O)COc1ccc(F)cc1F |
|
~%
[2-(2,4-difluor... CAS#:366-98-3 |
| Literature: Svarnas; Howard Journal of the American Chemical Society, 1955 , vol. 77, p. 3924 |
|
~%
[2-(2,4-difluor... CAS#:366-98-3 |
| Literature: Svarnas; Howard Journal of the American Chemical Society, 1955 , vol. 77, p. 3924 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2,4-Difluor-phenoxy)-essigsaeure-anhydrid |
| (2,4-difluoro-phenoxy)-acetic acid-anhydride |