4-butyl-2-nitroaniline structure
|
Common Name | 4-butyl-2-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 3663-22-7 | Molecular Weight | 194.23000 | |
| Density | 1.146g/cm3 | Boiling Point | 338.3ºC at 760mmHg | |
| Molecular Formula | C10H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.4ºC | |
| Name | 4-butyl-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 338.3ºC at 760mmHg |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23000 |
| Flash Point | 158.4ºC |
| Exact Mass | 194.10600 |
| PSA | 71.84000 |
| LogP | 3.62400 |
| Index of Refraction | 1.573 |
| InChIKey | RAKSJFYIAHRHCH-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(N)c([N+](=O)[O-])c1 |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Butyl-2-nitro-anilin |
| 4-butyl-2-nitro-aniline |
| 3-Nitro-4-amino-1-butyl-benzol |
| EINECS 222-916-1 |
| n-butyl-4 nitro-2 aniline |
| 4-(n-butyl)-2-nitroaniline |
| Benzenamine,4-butyl-2-nitro |